C19H24F3N3O8S — CID 121372747
[(3S,5S,6R)-4-azido-5-butoxy-6-methoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate (PubChem CID 121372747) has the molecular formula C19H24F3N3O8S and a molecular weight of 511.48 g/mol. Its IUPAC name is [(3S,5S,6R)-4-azido-5-butoxy-6-methoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(3S,5S,6R)-4-azido-5-butoxy-6-methoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 121372747 |
| Molecular Formula | C19H24F3N3O8S |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | [(3S,5S,6R)-4-azido-5-butoxy-6-methoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate |
| SMILES | CCCCO[C@H]1C(N=[N+]=[N-])[C@H](OS(=O)(=O)C(F)(F)F)C(COC(=O)c2ccccc2)O[C@H]1OC |
| InChI | InChI=1S/C19H24F3N3O8S/c1-3-4-10-30-16-14(24-25-23)15(33-34(27,28)19(20,21)22)13(32-18(16)29-2)11-31-17(26)12-8-6-5-7-9-12/h5-9,13-16,18H,3-4,10-11H2,1-2H3/t13?,14?,15-,16+,18-/m1/s1 |
| InChIKey | NQPJAHAXKROEMZ-OUZBTXLXSA-N |
| XLogP | 3.31 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|