C22H21F4N3O8S — CID 11295985
[(2R,3R,4R,5R,6R)-3-azido-2-fluoro-5-phenylmethoxy-6-(2,2,2-trifluoroethoxysulfonyloxymethyl)oxan-4-yl] benzoate (PubChem CID 11295985) has the molecular formula C22H21F4N3O8S and a molecular weight of 563.48 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3-azido-2-fluoro-5-phenylmethoxy-6-(2,2,2-trifluoroethoxysulfonyloxymethyl)oxan-4-yl] benzoate.
| Compound Name | [(2R,3R,4R,5R,6R)-3-azido-2-fluoro-5-phenylmethoxy-6-(2,2,2-trifluoroethoxysulfonyloxymethyl)oxan-4-yl] benzoate |
|---|---|
| PubChem CID | 11295985 |
| Molecular Formula | C22H21F4N3O8S |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3-azido-2-fluoro-5-phenylmethoxy-6-(2,2,2-trifluoroethoxysulfonyloxymethyl)oxan-4-yl] benzoate |
| SMILES | [N-]=[N+]=N[C@@H]1[C@@H](OC(=O)c2ccccc2)[C@@H](OCc2ccccc2)[C@@H](COS(=O)(=O)OCC(F)(F)F)O[C@@H]1F |
| InChI | InChI=1S/C22H21F4N3O8S/c23-20-17(28-29-27)19(37-21(30)15-9-5-2-6-10-15)18(33-11-14-7-3-1-4-8-14)16(36-20)12-34-38(31,32)35-13-22(24,25)26/h1-10,16-20H,11-13H2/t16-,17-,18+,19-,20+/m1/s1 |
| InChIKey | XYGPWNCSCKDUIV-OBKDMQGPSA-N |
| XLogP | 4.01 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|