C20H17N3O5 — CID 11211161
[(2S,3R,4R)-3-azido-4-benzoyloxy-3,4-dihydro-2H-pyran-2-yl]methyl benzoate (PubChem CID 11211161) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is [(2S,3R,4R)-3-azido-4-benzoyloxy-3,4-dihydro-2H-pyran-2-yl]methyl benzoate.
| Compound Name | [(2S,3R,4R)-3-azido-4-benzoyloxy-3,4-dihydro-2H-pyran-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 11211161 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [(2S,3R,4R)-3-azido-4-benzoyloxy-3,4-dihydro-2H-pyran-2-yl]methyl benzoate |
| SMILES | [N-]=[N+]=N[C@@H]1[C@H](OC(=O)c2ccccc2)C=CO[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17N3O5/c21-23-22-18-16(28-20(25)15-9-5-2-6-10-15)11-12-26-17(18)13-27-19(24)14-7-3-1-4-8-14/h1-12,16-18H,13H2/t16-,17-,18-/m1/s1 |
| InChIKey | ZJRQHWIBKDAKNL-KZNAEPCWSA-N |
| XLogP | 3.66 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|