C22H22F3N3O8S — CID 91484025
[(3R,4R,6S)-4-azido-6-methoxy-5-phenylmethoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate (PubChem CID 91484025) has the molecular formula C22H22F3N3O8S and a molecular weight of 545.49 g/mol. Its IUPAC name is [(3R,4R,6S)-4-azido-6-methoxy-5-phenylmethoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate.
| Compound Name | [(3R,4R,6S)-4-azido-6-methoxy-5-phenylmethoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 91484025 |
| Molecular Formula | C22H22F3N3O8S |
| Molecular Weight | 545.49 g/mol |
| Exact Mass | 545.11 |
| IUPAC Name | [(3R,4R,6S)-4-azido-6-methoxy-5-phenylmethoxy-3-(trifluoromethylsulfonyloxy)oxan-2-yl]methyl benzoate |
| SMILES | CO[C@H]1OC(COC(=O)c2ccccc2)[C@H](OS(=O)(=O)C(F)(F)F)[C@H](N=[N+]=[N-])C1OCc1ccccc1 |
| InChI | InChI=1S/C22H22F3N3O8S/c1-32-21-19(33-12-14-8-4-2-5-9-14)17(27-28-26)18(36-37(30,31)22(23,24)25)16(35-21)13-34-20(29)15-10-6-3-7-11-15/h2-11,16-19,21H,12-13H2,1H3/t16?,17-,18-,19?,21-/m0/s1 |
| InChIKey | MCTNYCADKUGVLA-PQSVVJLCSA-N |
| XLogP | 3.71 |
| TPSA | 146.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|