C21H27NO6 — CID 6444054
[(3aS,5S,6R,7S,7aS)-7-[(E)-but-2-enoxy]-2-methyl-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-6-yl] acetate (PubChem CID 6444054) has the molecular formula C21H27NO6 and a molecular weight of 389.45 g/mol. Its IUPAC name is [(3aS,5S,6R,7S,7aS)-7-[(E)-but-2-enoxy]-2-methyl-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-6-yl] acetate.
| Compound Name | [(3aS,5S,6R,7S,7aS)-7-[(E)-but-2-enoxy]-2-methyl-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-6-yl] acetate |
|---|---|
| PubChem CID | 6444054 |
| Molecular Formula | C21H27NO6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | [(3aS,5S,6R,7S,7aS)-7-[(E)-but-2-enoxy]-2-methyl-5-(phenylmethoxymethyl)-5,6,7,7a-tetrahydro-3aH-pyrano[3,2-d][1,3]oxazol-6-yl] acetate |
| SMILES | C/C=C/CO[C@H]1[C@@H]2N=C(C)O[C@@H]2O[C@@H](COCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H27NO6/c1-4-5-11-25-20-18-21(26-14(2)22-18)28-17(19(20)27-15(3)23)13-24-12-16-9-7-6-8-10-16/h4-10,17-21H,11-13H2,1-3H3/b5-4+/t17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | WGLSLLTXEVNTGP-KCVDAPTQSA-N |
| XLogP | 2.64 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|