C30H35N7O5 — CID 10030993
2-[2-[[2-[1-(6-ethanimidoyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)ethyl]-3-(2-methoxyethyl)benzimidazole-5-carbonyl]amino]ethoxy]benzoic acid (PubChem CID 10030993) has the molecular formula C30H35N7O5 and a molecular weight of 573.65 g/mol. Its IUPAC name is 2-[2-[[2-[1-(6-ethanimidoyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)ethyl]-3-(2-methoxyethyl)benzimidazole-5-carbonyl]amino]ethoxy]benzoic acid.
| Compound Name | 2-[2-[[2-[1-(6-ethanimidoyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)ethyl]-3-(2-methoxyethyl)benzimidazole-5-carbonyl]amino]ethoxy]benzoic acid |
|---|---|
| PubChem CID | 10030993 |
| Molecular Formula | C30H35N7O5 |
| Molecular Weight | 573.65 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | 2-[2-[[2-[1-(6-ethanimidoyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridin-2-yl)ethyl]-3-(2-methoxyethyl)benzimidazole-5-carbonyl]amino]ethoxy]benzoic acid |
| SMILES | [H]/N=C(\C)C1Cc2nc(C(C)c3nc4ccc(C(=O)NCCOc5ccccc5C(=O)O)cc4n3CCOC)[nH]c2CN1 |
| InChI | InChI=1S/C30H35N7O5/c1-17(27-34-23-15-22(18(2)31)33-16-24(23)35-27)28-36-21-9-8-19(14-25(21)37(28)11-13-41-3)29(38)32-10-12-42-26-7-5-4-6-20(26)30(39)40/h4-9,14,17,22,31,33H,10-13,15-16H2,1-3H3,(H,32,38)(H,34,35)(H,39,40)/b31-18+ |
| InChIKey | VFOCTOGGEFKXPN-FDAWAROLSA-N |
| XLogP | 3.12 |
| TPSA | 167.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|