C34H43N2O11S3+ — CID 10033022
6-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid (PubChem CID 10033022) has the molecular formula C34H43N2O11S3+ and a molecular weight of 751.92 g/mol. Its IUPAC name is 6-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid.
| Compound Name | 6-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 10033022 |
| Molecular Formula | C34H43N2O11S3+ |
| Molecular Weight | 751.92 g/mol |
| Exact Mass | 751.20 |
| IUPAC Name | 6-[(2E)-2-[(2E,4E)-5-[3,3-dimethyl-5-sulfo-1-(4-sulfobutyl)indol-1-ium-2-yl]penta-2,4-dienylidene]-3-methyl-5-sulfo-1H-indol-3-yl]hexanoic acid |
| SMILES | CC1(C)C(/C=C/C=C/C=C2/Nc3ccc(S(=O)(=O)O)cc3C2(C)CCCCCC(=O)O)=[N+](CCCCS(=O)(=O)O)c2ccc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C34H42N2O11S3/c1-33(2)27-23-25(50(45,46)47)16-18-29(27)36(20-10-11-21-48(39,40)41)31(33)13-7-4-6-12-30-34(3,19-9-5-8-14-32(37)38)26-22-24(49(42,43)44)15-17-28(26)35-30/h4,6-7,12-13,15-18,22-23H,5,8-11,14,19-21H2,1-3H3,(H4,37,38,39,40,41,42,43,44,45,46,47)/p+1 |
| InChIKey | UBTTXTQCGNYCEM-UHFFFAOYSA-O |
| XLogP | 5.64 |
| TPSA | 215.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.92 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|