C10H22OSi — CID 10035353
(1R)-1-[(1S,2R)-2-trimethylsilylcyclopropyl]butan-1-ol (PubChem CID 10035353) has the molecular formula C10H22OSi and a molecular weight of 186.37 g/mol. Its IUPAC name is (1R)-1-[(1S,2R)-2-trimethylsilylcyclopropyl]butan-1-ol.
| Compound Name | (1R)-1-[(1S,2R)-2-trimethylsilylcyclopropyl]butan-1-ol |
|---|---|
| PubChem CID | 10035353 |
| Molecular Formula | C10H22OSi |
| Molecular Weight | 186.37 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (1R)-1-[(1S,2R)-2-trimethylsilylcyclopropyl]butan-1-ol |
| SMILES | CCC[C@@H](O)[C@@H]1C[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C10H22OSi/c1-5-6-9(11)8-7-10(8)12(2,3)4/h8-11H,5-7H2,1-4H3/t8-,9+,10+/m0/s1 |
| InChIKey | XVEMVNPSDAKFNW-IVZWLZJFSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|