C12H21NO2 — CID 10036061
(2S,4S)-4-(cyclohexylmethyl)pyrrolidine-2-carboxylic acid (PubChem CID 10036061) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is (2S,4S)-4-(cyclohexylmethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-(cyclohexylmethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10036061 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (2S,4S)-4-(cyclohexylmethyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](CC2CCCCC2)CN1 |
| InChI | InChI=1S/C12H21NO2/c14-12(15)11-7-10(8-13-11)6-9-4-2-1-3-5-9/h9-11,13H,1-8H2,(H,14,15)/t10-,11-/m0/s1 |
| InChIKey | AKDCUWCBNFWCTN-QWRGUYRKSA-N |
| XLogP | 2.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |