C8H11NO2 — CID 118274051
(2R)-4-prop-2-ynylpyrrolidine-2-carboxylic acid (PubChem CID 118274051) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (2R)-4-prop-2-ynylpyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-4-prop-2-ynylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118274051 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (2R)-4-prop-2-ynylpyrrolidine-2-carboxylic acid |
| SMILES | C#CCC1CN[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C8H11NO2/c1-2-3-6-4-7(8(10)11)9-5-6/h1,6-7,9H,3-5H2,(H,10,11)/t6?,7-/m1/s1 |
| InChIKey | QXUSFQCJGVVVJR-COBSHVIPSA-N |
| XLogP | 0.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|