C7H9F6N — CID 10036439
3,5-bis(trifluoromethyl)piperidine (PubChem CID 10036439) has the molecular formula C7H9F6N and a molecular weight of 221.14 g/mol. Its IUPAC name is 3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 10036439 |
| Molecular Formula | C7H9F6N |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | 3,5-bis(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)C1CNCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C7H9F6N/c8-6(9,10)4-1-5(3-14-2-4)7(11,12)13/h4-5,14H,1-3H2 |
| InChIKey | WNSWTDWANMVMDB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |