C15H22N2 — CID 10036847
(5E)-5-[(5E)-5-(3,4-dihydro-2H-pyridin-5-ylidene)pentylidene]-3,4-dihydro-2H-pyridine (PubChem CID 10036847) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (5E)-5-[(5E)-5-(3,4-dihydro-2H-pyridin-5-ylidene)pentylidene]-3,4-dihydro-2H-pyridine.
| Compound Name | (5E)-5-[(5E)-5-(3,4-dihydro-2H-pyridin-5-ylidene)pentylidene]-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 10036847 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (5E)-5-[(5E)-5-(3,4-dihydro-2H-pyridin-5-ylidene)pentylidene]-3,4-dihydro-2H-pyridine |
| SMILES | C1=NCCC/C1=C\CCC/C=C1/C=NCCC1 |
| InChI | InChI=1S/C15H22N2/c1(2-6-14-8-4-10-16-12-14)3-7-15-9-5-11-17-13-15/h6-7,12-13H,1-5,8-11H2/b14-6+,15-7+ |
| InChIKey | PLRJVKFUOXCVDV-MKFXEVHTSA-N |
| XLogP | 3.74 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|