C10H15N — CID 70267509
5-but-3-enyl-4-methyl-2,3-dihydropyridine (PubChem CID 70267509) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 5-but-3-enyl-4-methyl-2,3-dihydropyridine.
| Compound Name | 5-but-3-enyl-4-methyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 70267509 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 5-but-3-enyl-4-methyl-2,3-dihydropyridine |
| SMILES | C=CCCC1=C(C)CCN=C1 |
| InChI | InChI=1S/C10H15N/c1-3-4-5-10-8-11-7-6-9(10)2/h3,8H,1,4-7H2,2H3 |
| InChIKey | GVZZOHWQHXZHAV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|