About 2-methyl-2-pentenal N-allylimine
2-methyl-2-pentenal N-allylimine (PubChem CID 129747538) has the molecular formula C9H15N
and a molecular weight of 137.22 g/mol. Its IUPAC name is 2-methyl-N-prop-2-enylpent-2-en-1-imine.
Molecular Properties
| Compound Name | 2-methyl-2-pentenal N-allylimine |
| PubChem CID | 129747538 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.22 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 2-methyl-N-prop-2-enylpent-2-en-1-imine |
| SMILES | CCC=C(C)C=NCC=C |
| InChI | InChI=1S/C9H15N/c1-4-6-9(3)8-10-7-5-2/h5-6,8H,2,4,7H2,1,3H3 |
| InChIKey | JRQMFKNUWATQGQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | 143 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-pentenal N-allylimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-pentenal N-allylimine?
The IUPAC name of 2-methyl-2-pentenal N-allylimine (CID 129747538) is 2-methyl-N-prop-2-enylpent-2-en-1-imine.
What is the SMILES notation for 2-methyl-2-pentenal N-allylimine?
The canonical SMILES for 2-methyl-2-pentenal N-allylimine is CCC=C(C)C=NCC=C.
What is the InChIKey of 2-methyl-2-pentenal N-allylimine?
The InChIKey is JRQMFKNUWATQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N/c1-4-6-9(3)8-10-7-5-2/h5-6,8H,2,4,7H2,1,3H3.
What are the key properties of 2-methyl-2-pentenal N-allylimine?
2-methyl-2-pentenal N-allylimine has a molecular weight of 137.22 g/mol, XLogP of 2.30, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-pentenal N-allylimine is sourced from PubChem (CID 129747538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).