C11H10N2OS2 — CID 10037760
1-(4-amino-3-phenyl-2-sulfanylidene-1,3-thiazol-5-yl)ethanone (PubChem CID 10037760) has the molecular formula C11H10N2OS2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 1-(4-amino-3-phenyl-2-sulfanylidene-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(4-amino-3-phenyl-2-sulfanylidene-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 10037760 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1-(4-amino-3-phenyl-2-sulfanylidene-1,3-thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1sc(=S)n(-c2ccccc2)c1N |
| InChI | InChI=1S/C11H10N2OS2/c1-7(14)9-10(12)13(11(15)16-9)8-5-3-2-4-6-8/h2-6H,12H2,1H3 |
| InChIKey | MEPDJLBQBYSCKM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|