C17H16N2O2 — CID 10039301
3,8a-diphenyl-6,7-dihydro-5H-[1,2,4]oxadiazolo[5,4-b][1,3]oxazine (PubChem CID 10039301) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 3,8a-diphenyl-6,7-dihydro-5H-[1,2,4]oxadiazolo[5,4-b][1,3]oxazine.
| Compound Name | 3,8a-diphenyl-6,7-dihydro-5H-[1,2,4]oxadiazolo[5,4-b][1,3]oxazine |
|---|---|
| PubChem CID | 10039301 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 3,8a-diphenyl-6,7-dihydro-5H-[1,2,4]oxadiazolo[5,4-b][1,3]oxazine |
| SMILES | c1ccc(C2=NOC3(c4ccccc4)OCCCN23)cc1 |
| InChI | InChI=1S/C17H16N2O2/c1-3-8-14(9-4-1)16-18-21-17(15-10-5-2-6-11-15)19(16)12-7-13-20-17/h1-6,8-11H,7,12-13H2 |
| InChIKey | YKQZUGNUVHNHLJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |