About S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate
S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate (PubChem CID 10039891) has the molecular formula C15H30O3S
and a molecular weight of 290.47 g/mol. Its IUPAC name is S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate.
Molecular Properties
| Compound Name | S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate |
| PubChem CID | 10039891 |
| Molecular Formula | C15H30O3S |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate |
| SMILES | CCCCCCCCOC[C@H](CO)SC(=O)CCC |
| InChI | InChI=1S/C15H30O3S/c1-3-5-6-7-8-9-11-18-13-14(12-16)19-15(17)10-4-2/h14,16H,3-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | QXFYIKUVWRDTRA-AWEZNQCLSA-N |
| XLogP | 3.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate?
The IUPAC name of S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate (CID 10039891) is S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate.
What is the SMILES notation for S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate?
The canonical SMILES for S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate is CCCCCCCCOC[C@H](CO)SC(=O)CCC.
What is the InChIKey of S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate?
The InChIKey is QXFYIKUVWRDTRA-AWEZNQCLSA-N. The full InChI is InChI=1S/C15H30O3S/c1-3-5-6-7-8-9-11-18-13-14(12-16)19-15(17)10-4-2/h14,16H,3-13H2,1-2H3/t14-/m0/s1.
What are the key properties of S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate?
S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate has a molecular weight of 290.47 g/mol, XLogP of 3.78, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2S)-1-hydroxy-3-octoxypropan-2-yl] butanethioate is sourced from PubChem (CID 10039891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).