About S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate
S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate (PubChem CID 10247460) has the molecular formula C20H32O3S
and a molecular weight of 352.54 g/mol. Its IUPAC name is S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate.
Molecular Properties
| Compound Name | S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate |
| PubChem CID | 10247460 |
| Molecular Formula | C20H32O3S |
| Molecular Weight | 352.54 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate |
| SMILES | CCCCCCCCCC(=O)S[C@@H](CO)COCc1ccccc1 |
| InChI | InChI=1S/C20H32O3S/c1-2-3-4-5-6-7-11-14-20(22)24-19(15-21)17-23-16-18-12-9-8-10-13-18/h8-10,12-13,19,21H,2-7,11,14-17H2,1H3/t19-/m0/s1 |
| InChIKey | FIUMKXJRBITEIP-IBGZPJMESA-N |
| XLogP | 4.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.54 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate?
The IUPAC name of S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate (CID 10247460) is S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate.
What is the SMILES notation for S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate?
The canonical SMILES for S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate is CCCCCCCCCC(=O)S[C@@H](CO)COCc1ccccc1.
What is the InChIKey of S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate?
The InChIKey is FIUMKXJRBITEIP-IBGZPJMESA-N. The full InChI is InChI=1S/C20H32O3S/c1-2-3-4-5-6-7-11-14-20(22)24-19(15-21)17-23-16-18-12-9-8-10-13-18/h8-10,12-13,19,21H,2-7,11,14-17H2,1H3/t19-/m0/s1.
What are the key properties of S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate?
S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate has a molecular weight of 352.54 g/mol, XLogP of 4.96, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[(2S)-1-hydroxy-3-phenylmethoxypropan-2-yl] decanethioate is sourced from PubChem (CID 10247460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).