C21H32O3 — CID 10042411
methyl 3-[(3R,3aR,5aS,6R,9aS,9bS)-3-ethenyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propanoate (PubChem CID 10042411) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is methyl 3-[(3R,3aR,5aS,6R,9aS,9bS)-3-ethenyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propanoate.
| Compound Name | methyl 3-[(3R,3aR,5aS,6R,9aS,9bS)-3-ethenyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propanoate |
|---|---|
| PubChem CID | 10042411 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | methyl 3-[(3R,3aR,5aS,6R,9aS,9bS)-3-ethenyl-3a,6-dimethyl-7-oxo-1,2,3,4,5,5a,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propanoate |
| SMILES | C=C[C@H]1CC[C@H]2[C@@H]3CCC(=O)[C@](C)(CCC(=O)OC)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H32O3/c1-5-14-6-8-16-15-7-9-18(22)21(3,13-11-19(23)24-4)17(15)10-12-20(14,16)2/h5,14-17H,1,6-13H2,2-4H3/t14-,15-,16-,17-,20+,21+/m0/s1 |
| InChIKey | RFLXJVIJRIVFGE-OPLYSGQSSA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|