C21H27NOS — CID 10042965
2-(1-benzylpiperidin-4-yl)-1-(4-methylsulfanylphenyl)ethanol (PubChem CID 10042965) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is 2-(1-benzylpiperidin-4-yl)-1-(4-methylsulfanylphenyl)ethanol.
| Compound Name | 2-(1-benzylpiperidin-4-yl)-1-(4-methylsulfanylphenyl)ethanol |
|---|---|
| PubChem CID | 10042965 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-(1-benzylpiperidin-4-yl)-1-(4-methylsulfanylphenyl)ethanol |
| SMILES | CSc1ccc(C(O)CC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C21H27NOS/c1-24-20-9-7-19(8-10-20)21(23)15-17-11-13-22(14-12-17)16-18-5-3-2-4-6-18/h2-10,17,21,23H,11-16H2,1H3 |
| InChIKey | KTYAFUISADDFOQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |