C29H35NO2S — CID 70682190
1-(4-ethylphenyl)sulfanyl-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-2-ol (PubChem CID 70682190) has the molecular formula C29H35NO2S and a molecular weight of 461.67 g/mol. Its IUPAC name is 1-(4-ethylphenyl)sulfanyl-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-2-ol.
| Compound Name | 1-(4-ethylphenyl)sulfanyl-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 70682190 |
| Molecular Formula | C29H35NO2S |
| Molecular Weight | 461.67 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 1-(4-ethylphenyl)sulfanyl-3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propan-2-ol |
| SMILES | CCc1ccc(SCC(O)CN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H35NO2S/c1-2-23-13-15-28(16-14-23)33-22-27(31)21-30-19-17-26(18-20-30)29(32,24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-16,26-27,31-32H,2,17-22H2,1H3 |
| InChIKey | PZYLYWMFGNTAAF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |