C17H21BrO4 — CID 10044571
methyl 2-[(2-bromo-4-methoxyphenyl)methyl]-1-methyl-3-oxocyclohexane-1-carboxylate (PubChem CID 10044571) has the molecular formula C17H21BrO4 and a molecular weight of 369.26 g/mol. Its IUPAC name is methyl 2-[(2-bromo-4-methoxyphenyl)methyl]-1-methyl-3-oxocyclohexane-1-carboxylate.
| Compound Name | methyl 2-[(2-bromo-4-methoxyphenyl)methyl]-1-methyl-3-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10044571 |
| Molecular Formula | C17H21BrO4 |
| Molecular Weight | 369.26 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | methyl 2-[(2-bromo-4-methoxyphenyl)methyl]-1-methyl-3-oxocyclohexane-1-carboxylate |
| SMILES | COC(=O)C1(C)CCCC(=O)C1Cc1ccc(OC)cc1Br |
| InChI | InChI=1S/C17H21BrO4/c1-17(16(20)22-3)8-4-5-15(19)13(17)9-11-6-7-12(21-2)10-14(11)18/h6-7,10,13H,4-5,8-9H2,1-3H3 |
| InChIKey | BDWWVRCWCCQAFX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |