C17H16ClF3N4O — CID 10045603
2-(3-chloroanilino)-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 10045603) has the molecular formula C17H16ClF3N4O and a molecular weight of 384.79 g/mol. Its IUPAC name is 2-(3-chloroanilino)-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(3-chloroanilino)-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10045603 |
| Molecular Formula | C17H16ClF3N4O |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-(3-chloroanilino)-N-(cyclobutylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | O=C(NCC1CCC1)c1cnc(Nc2cccc(Cl)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C17H16ClF3N4O/c18-11-5-2-6-12(7-11)24-16-23-9-13(14(25-16)17(19,20)21)15(26)22-8-10-3-1-4-10/h2,5-7,9-10H,1,3-4,8H2,(H,22,26)(H,23,24,25) |
| InChIKey | FOIIYTALCBINLZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |