C18H18ClF3N4O2 — CID 10070428
2-(3-chloroanilino)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 10070428) has the molecular formula C18H18ClF3N4O2 and a molecular weight of 414.82 g/mol. Its IUPAC name is 2-(3-chloroanilino)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(3-chloroanilino)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10070428 |
| Molecular Formula | C18H18ClF3N4O2 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-(3-chloroanilino)-N-(oxan-4-ylmethyl)-4-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | O=C(NCC1CCOCC1)c1cnc(Nc2cccc(Cl)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C18H18ClF3N4O2/c19-12-2-1-3-13(8-12)25-17-24-10-14(15(26-17)18(20,21)22)16(27)23-9-11-4-6-28-7-5-11/h1-3,8,10-11H,4-7,9H2,(H,23,27)(H,24,25,26) |
| InChIKey | BIFWAJIKBGURHJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |