C20H28N6O3 — CID 10046543
4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(3-methoxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 10046543) has the molecular formula C20H28N6O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(3-methoxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(3-methoxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10046543 |
| Molecular Formula | C20H28N6O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(3-methoxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | COc1cccc(CNc2ncc([N+](=O)[O-])c(NCC3CCC(CN)CC3)n2)c1 |
| InChI | InChI=1S/C20H28N6O3/c1-29-17-4-2-3-16(9-17)12-23-20-24-13-18(26(27)28)19(25-20)22-11-15-7-5-14(10-21)6-8-15/h2-4,9,13-15H,5-8,10-12,21H2,1H3,(H2,22,23,24,25) |
| InChIKey | POUPXWBYQNVIPM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|