C21H16FN3O5 — CID 10047105
[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] N,N-dimethylcarbamate (PubChem CID 10047105) has the molecular formula C21H16FN3O5 and a molecular weight of 409.37 g/mol. Its IUPAC name is [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] N,N-dimethylcarbamate.
| Compound Name | [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 10047105 |
| Molecular Formula | C21H16FN3O5 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1c2c(c(O)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C21H16FN3O5/c1-24(2)21(29)30-18-13-4-3-9-23-16(13)17(26)14-15(18)20(28)25(19(14)27)10-11-5-7-12(22)8-6-11/h3-9,26H,10H2,1-2H3 |
| InChIKey | LECMSGCIFVVUCD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|