C19H26ClN3O6 — CID 10048189
tert-butyl 4-[(1S)-1-(6-chloropyrazin-2-yl)-2-ethoxycarbonyloxy-2-oxoethyl]piperidine-1-carboxylate (PubChem CID 10048189) has the molecular formula C19H26ClN3O6 and a molecular weight of 427.89 g/mol. Its IUPAC name is tert-butyl 4-[(1S)-1-(6-chloropyrazin-2-yl)-2-ethoxycarbonyloxy-2-oxoethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1S)-1-(6-chloropyrazin-2-yl)-2-ethoxycarbonyloxy-2-oxoethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10048189 |
| Molecular Formula | C19H26ClN3O6 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | tert-butyl 4-[(1S)-1-(6-chloropyrazin-2-yl)-2-ethoxycarbonyloxy-2-oxoethyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)OC(=O)[C@H](c1cncc(Cl)n1)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H26ClN3O6/c1-5-27-18(26)28-16(24)15(13-10-21-11-14(20)22-13)12-6-8-23(9-7-12)17(25)29-19(2,3)4/h10-12,15H,5-9H2,1-4H3/t15-/m0/s1 |
| InChIKey | UGPPERCUXIZKDR-HNNXBMFYSA-N |
| XLogP | 3.56 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|