C29H22O5 — CID 10049428
6-[2,4-bis(phenylmethoxy)phenyl]furo[2,3-f][1,3]benzodioxole (PubChem CID 10049428) has the molecular formula C29H22O5 and a molecular weight of 450.49 g/mol. Its IUPAC name is 6-[2,4-bis(phenylmethoxy)phenyl]furo[2,3-f][1,3]benzodioxole.
| Compound Name | 6-[2,4-bis(phenylmethoxy)phenyl]furo[2,3-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 10049428 |
| Molecular Formula | C29H22O5 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 6-[2,4-bis(phenylmethoxy)phenyl]furo[2,3-f][1,3]benzodioxole |
| SMILES | c1ccc(COc2ccc(-c3cc4cc5c(cc4o3)OCO5)c(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H22O5/c1-3-7-20(8-4-1)17-30-23-11-12-24(26(15-23)31-18-21-9-5-2-6-10-21)27-13-22-14-28-29(33-19-32-28)16-25(22)34-27/h1-16H,17-19H2 |
| InChIKey | HKAGAWYBQMRSFF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |