C25H31ClN2O2 — CID 100500131
1-[(3-chlorophenyl)methyl]-N-[(4-phenyloxan-4-yl)methyl]piperidine-4-carboxamide (PubChem CID 100500131) has the molecular formula C25H31ClN2O2 and a molecular weight of 426.99 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-N-[(4-phenyloxan-4-yl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-N-[(4-phenyloxan-4-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 100500131 |
| Molecular Formula | C25H31ClN2O2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-N-[(4-phenyloxan-4-yl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CCOCC1)C1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C25H31ClN2O2/c26-23-8-4-5-20(17-23)18-28-13-9-21(10-14-28)24(29)27-19-25(11-15-30-16-12-25)22-6-2-1-3-7-22/h1-8,17,21H,9-16,18-19H2,(H,27,29) |
| InChIKey | DBRPEVLWEAMLAZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |