C17H23ClN2O2 — CID 119749930
N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]pyrrolidine-3-carboxamide (PubChem CID 119749930) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 119749930 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[[4-(3-chlorophenyl)oxan-4-yl]methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCC1(c2cccc(Cl)c2)CCOCC1)C1CCNC1 |
| InChI | InChI=1S/C17H23ClN2O2/c18-15-3-1-2-14(10-15)17(5-8-22-9-6-17)12-20-16(21)13-4-7-19-11-13/h1-3,10,13,19H,4-9,11-12H2,(H,20,21) |
| InChIKey | MRRARYVLUIUEDL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |