C16H23ClN2O — CID 119699128
N-[(1-phenylcyclobutyl)methyl]pyrrolidine-3-carboxamide;hydrochloride (PubChem CID 119699128) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is N-[(1-phenylcyclobutyl)methyl]pyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | N-[(1-phenylcyclobutyl)methyl]pyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119699128 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[(1-phenylcyclobutyl)methyl]pyrrolidine-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCC1(c2ccccc2)CCC1)C1CCNC1 |
| InChI | InChI=1S/C16H22N2O.ClH/c19-15(13-7-10-17-11-13)18-12-16(8-4-9-16)14-5-2-1-3-6-14;/h1-3,5-6,13,17H,4,7-12H2,(H,18,19);1H |
| InChIKey | WWVUPHAHAHTLDL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |