C28H38BNO4 — CID 10050025
(4S)-3-[(Z,3R)-1-dibutylboranyloxy-3-(4-methoxyphenyl)but-1-enyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10050025) has the molecular formula C28H38BNO4 and a molecular weight of 463.43 g/mol. Its IUPAC name is (4S)-3-[(Z,3R)-1-dibutylboranyloxy-3-(4-methoxyphenyl)but-1-enyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(Z,3R)-1-dibutylboranyloxy-3-(4-methoxyphenyl)but-1-enyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10050025 |
| Molecular Formula | C28H38BNO4 |
| Molecular Weight | 463.43 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | (4S)-3-[(Z,3R)-1-dibutylboranyloxy-3-(4-methoxyphenyl)but-1-enyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CCCCB(CCCC)O/C(=C\[C@@H](C)c1ccc(OC)cc1)N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H38BNO4/c1-5-7-18-29(19-8-6-2)34-27(20-22(3)23-14-16-25(32-4)17-15-23)30-26(21-33-28(30)31)24-12-10-9-11-13-24/h9-17,20,22,26H,5-8,18-19,21H2,1-4H3/b27-20-/t22-,26-/m1/s1 |
| InChIKey | XCXCPXIAAXMWLT-RLXDMTHXSA-N |
| XLogP | 7.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.43 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|