C23H16Cl2N2O3 — CID 100500618
N-(2,3-dichlorophenyl)-2-[5-(3-methoxyphenyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 100500618) has the molecular formula C23H16Cl2N2O3 and a molecular weight of 439.30 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[5-(3-methoxyphenyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[5-(3-methoxyphenyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100500618 |
| Molecular Formula | C23H16Cl2N2O3 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[5-(3-methoxyphenyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | COc1cccc(-c2cnc(-c3ccccc3C(=O)Nc3cccc(Cl)c3Cl)o2)c1 |
| InChI | InChI=1S/C23H16Cl2N2O3/c1-29-15-7-4-6-14(12-15)20-13-26-23(30-20)17-9-3-2-8-16(17)22(28)27-19-11-5-10-18(24)21(19)25/h2-13H,1H3,(H,27,28) |
| InChIKey | JAJSBNUDHUFMCK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |