C22H24N2O3 — CID 100501410
2-[5-(3-methoxyphenyl)-1,3-oxazol-2-yl]-N-[(2R)-pentan-2-yl]benzamide (PubChem CID 100501410) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[5-(3-methoxyphenyl)-1,3-oxazol-2-yl]-N-[(2R)-pentan-2-yl]benzamide.
| Compound Name | 2-[5-(3-methoxyphenyl)-1,3-oxazol-2-yl]-N-[(2R)-pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 100501410 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-[5-(3-methoxyphenyl)-1,3-oxazol-2-yl]-N-[(2R)-pentan-2-yl]benzamide |
| SMILES | CCC[C@@H](C)NC(=O)c1ccccc1-c1ncc(-c2cccc(OC)c2)o1 |
| InChI | InChI=1S/C22H24N2O3/c1-4-8-15(2)24-21(25)18-11-5-6-12-19(18)22-23-14-20(27-22)16-9-7-10-17(13-16)26-3/h5-7,9-15H,4,8H2,1-3H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | LVWUVOMIOISPQW-OAHLLOKOSA-N |
| XLogP | 4.94 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |