C24H34N2O5S — CID 100502728
N-[2-(4-ethylphenoxy)ethyl]-4-(N-methylsulfonyl-3-propan-2-yloxyanilino)butanamide (PubChem CID 100502728) has the molecular formula C24H34N2O5S and a molecular weight of 462.61 g/mol. Its IUPAC name is N-[2-(4-ethylphenoxy)ethyl]-4-(N-methylsulfonyl-3-propan-2-yloxyanilino)butanamide.
| Compound Name | N-[2-(4-ethylphenoxy)ethyl]-4-(N-methylsulfonyl-3-propan-2-yloxyanilino)butanamide |
|---|---|
| PubChem CID | 100502728 |
| Molecular Formula | C24H34N2O5S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[2-(4-ethylphenoxy)ethyl]-4-(N-methylsulfonyl-3-propan-2-yloxyanilino)butanamide |
| SMILES | CCc1ccc(OCCNC(=O)CCCN(c2cccc(OC(C)C)c2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H34N2O5S/c1-5-20-11-13-22(14-12-20)30-17-15-25-24(27)10-7-16-26(32(4,28)29)21-8-6-9-23(18-21)31-19(2)3/h6,8-9,11-14,18-19H,5,7,10,15-17H2,1-4H3,(H,25,27) |
| InChIKey | DEUNWGHFXSVWKC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|