C27H32N2O6S — CID 100503035
N-[2-(3-methoxyphenoxy)ethyl]-4-[(N-methylsulfonyl-3-propan-2-yloxyanilino)methyl]benzamide (PubChem CID 100503035) has the molecular formula C27H32N2O6S and a molecular weight of 512.63 g/mol. Its IUPAC name is N-[2-(3-methoxyphenoxy)ethyl]-4-[(N-methylsulfonyl-3-propan-2-yloxyanilino)methyl]benzamide.
| Compound Name | N-[2-(3-methoxyphenoxy)ethyl]-4-[(N-methylsulfonyl-3-propan-2-yloxyanilino)methyl]benzamide |
|---|---|
| PubChem CID | 100503035 |
| Molecular Formula | C27H32N2O6S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | N-[2-(3-methoxyphenoxy)ethyl]-4-[(N-methylsulfonyl-3-propan-2-yloxyanilino)methyl]benzamide |
| SMILES | COc1cccc(OCCNC(=O)c2ccc(CN(c3cccc(OC(C)C)c3)S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C27H32N2O6S/c1-20(2)35-26-10-5-7-23(17-26)29(36(4,31)32)19-21-11-13-22(14-12-21)27(30)28-15-16-34-25-9-6-8-24(18-25)33-3/h5-14,17-18,20H,15-16,19H2,1-4H3,(H,28,30) |
| InChIKey | IVGBZWPYEZFXSM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|