C26H28Cl2N2O4S — CID 100500616
4-[(3,4-dichloro-N-methylsulfonylanilino)methyl]-N-[2-(4-propylphenoxy)ethyl]benzamide (PubChem CID 100500616) has the molecular formula C26H28Cl2N2O4S and a molecular weight of 535.49 g/mol. Its IUPAC name is 4-[(3,4-dichloro-N-methylsulfonylanilino)methyl]-N-[2-(4-propylphenoxy)ethyl]benzamide.
| Compound Name | 4-[(3,4-dichloro-N-methylsulfonylanilino)methyl]-N-[2-(4-propylphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 100500616 |
| Molecular Formula | C26H28Cl2N2O4S |
| Molecular Weight | 535.49 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 4-[(3,4-dichloro-N-methylsulfonylanilino)methyl]-N-[2-(4-propylphenoxy)ethyl]benzamide |
| SMILES | CCCc1ccc(OCCNC(=O)c2ccc(CN(c3ccc(Cl)c(Cl)c3)S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C26H28Cl2N2O4S/c1-3-4-19-7-12-23(13-8-19)34-16-15-29-26(31)21-9-5-20(6-10-21)18-30(35(2,32)33)22-11-14-24(27)25(28)17-22/h5-14,17H,3-4,15-16,18H2,1-2H3,(H,29,31) |
| InChIKey | JWVMQHYAZLGPIW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.49 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|