C25H25Cl3N2O4S — CID 100507748
N-[2-(2,4-dimethylphenoxy)ethyl]-4-[(2,4,5-trichloro-N-methylsulfonylanilino)methyl]benzamide (PubChem CID 100507748) has the molecular formula C25H25Cl3N2O4S and a molecular weight of 555.91 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenoxy)ethyl]-4-[(2,4,5-trichloro-N-methylsulfonylanilino)methyl]benzamide.
| Compound Name | N-[2-(2,4-dimethylphenoxy)ethyl]-4-[(2,4,5-trichloro-N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 100507748 |
| Molecular Formula | C25H25Cl3N2O4S |
| Molecular Weight | 555.91 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | N-[2-(2,4-dimethylphenoxy)ethyl]-4-[(2,4,5-trichloro-N-methylsulfonylanilino)methyl]benzamide |
| SMILES | Cc1ccc(OCCNC(=O)c2ccc(CN(c3cc(Cl)c(Cl)cc3Cl)S(C)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C25H25Cl3N2O4S/c1-16-4-9-24(17(2)12-16)34-11-10-29-25(31)19-7-5-18(6-8-19)15-30(35(3,32)33)23-14-21(27)20(26)13-22(23)28/h4-9,12-14H,10-11,15H2,1-3H3,(H,29,31) |
| InChIKey | LSFAHRMTCXLVGV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.91 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|