C24H23Cl3N2O4S — CID 100507558
N-[2-(2-methylphenoxy)ethyl]-4-[(2,4,5-trichloro-N-methylsulfonylanilino)methyl]benzamide (PubChem CID 100507558) has the molecular formula C24H23Cl3N2O4S and a molecular weight of 541.88 g/mol. Its IUPAC name is N-[2-(2-methylphenoxy)ethyl]-4-[(2,4,5-trichloro-N-methylsulfonylanilino)methyl]benzamide.
| Compound Name | N-[2-(2-methylphenoxy)ethyl]-4-[(2,4,5-trichloro-N-methylsulfonylanilino)methyl]benzamide |
|---|---|
| PubChem CID | 100507558 |
| Molecular Formula | C24H23Cl3N2O4S |
| Molecular Weight | 541.88 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | N-[2-(2-methylphenoxy)ethyl]-4-[(2,4,5-trichloro-N-methylsulfonylanilino)methyl]benzamide |
| SMILES | Cc1ccccc1OCCNC(=O)c1ccc(CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C24H23Cl3N2O4S/c1-16-5-3-4-6-23(16)33-12-11-28-24(30)18-9-7-17(8-10-18)15-29(34(2,31)32)22-14-20(26)19(25)13-21(22)27/h3-10,13-14H,11-12,15H2,1-2H3,(H,28,30) |
| InChIKey | FUWSKCSUXAXMNC-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.88 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|