C29H30ClIN2O3 — CID 100503294
(2R)-2-[(3-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide (PubChem CID 100503294) has the molecular formula C29H30ClIN2O3 and a molecular weight of 616.93 g/mol. Its IUPAC name is (2R)-2-[(3-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide.
| Compound Name | (2R)-2-[(3-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100503294 |
| Molecular Formula | C29H30ClIN2O3 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.10 |
| IUPAC Name | (2R)-2-[(3-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-cyclopentyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCC1)[C@@H](Cc1ccccc1)N(Cc1cccc(Cl)c1)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C29H30ClIN2O3/c30-23-10-6-9-22(17-23)19-33(28(34)20-36-26-15-13-24(31)14-16-26)27(18-21-7-2-1-3-8-21)29(35)32-25-11-4-5-12-25/h1-3,6-10,13-17,25,27H,4-5,11-12,18-20H2,(H,32,35)/t27-/m1/s1 |
| InChIKey | JAVRCIPRYYPYBK-HHHXNRCGSA-N |
| XLogP | 6.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|