C30H32ClIN2O3 — CID 100605324
(2S)-2-[(4-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide (PubChem CID 100605324) has the molecular formula C30H32ClIN2O3 and a molecular weight of 630.95 g/mol. Its IUPAC name is (2S)-2-[(4-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[(4-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 100605324 |
| Molecular Formula | C30H32ClIN2O3 |
| Molecular Weight | 630.95 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | (2S)-2-[(4-chlorophenyl)methyl-[2-(4-iodophenoxy)acetyl]amino]-N-cyclohexyl-3-phenylpropanamide |
| SMILES | O=C(NC1CCCCC1)[C@H](Cc1ccccc1)N(Cc1ccc(Cl)cc1)C(=O)COc1ccc(I)cc1 |
| InChI | InChI=1S/C30H32ClIN2O3/c31-24-13-11-23(12-14-24)20-34(29(35)21-37-27-17-15-25(32)16-18-27)28(19-22-7-3-1-4-8-22)30(36)33-26-9-5-2-6-10-26/h1,3-4,7-8,11-18,26,28H,2,5-6,9-10,19-21H2,(H,33,36)/t28-/m0/s1 |
| InChIKey | YBSFCMWAWVMHNI-NDEPHWFRSA-N |
| XLogP | 6.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.95 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|