C30H41N3O2 — CID 10050627
N,N-diethyl-4-(3-methoxy-N-[(1R,5S)-8-(3-methylbut-2-enyl)-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide (PubChem CID 10050627) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is N,N-diethyl-4-(3-methoxy-N-[(1R,5S)-8-(3-methylbut-2-enyl)-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide.
| Compound Name | N,N-diethyl-4-(3-methoxy-N-[(1R,5S)-8-(3-methylbut-2-enyl)-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide |
|---|---|
| PubChem CID | 10050627 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | N,N-diethyl-4-(3-methoxy-N-[(1R,5S)-8-(3-methylbut-2-enyl)-8-azabicyclo[3.2.1]octan-3-yl]anilino)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(N(c2cccc(OC)c2)C2C[C@H]3CC[C@@H](C2)N3CC=C(C)C)cc1 |
| InChI | InChI=1S/C30H41N3O2/c1-6-31(7-2)30(34)23-11-13-24(14-12-23)33(27-9-8-10-29(21-27)35-5)28-19-25-15-16-26(20-28)32(25)18-17-22(3)4/h8-14,17,21,25-26,28H,6-7,15-16,18-20H2,1-5H3/t25-,26+,28? |
| InChIKey | GNNWUIPPEDZIJQ-XFAILSGYSA-N |
| XLogP | 6.28 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|