C19H24F5N3O4S — CID 10051060
N-hydroxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclobutane-1-carboxamide (PubChem CID 10051060) has the molecular formula C19H24F5N3O4S and a molecular weight of 485.48 g/mol. Its IUPAC name is N-hydroxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclobutane-1-carboxamide.
| Compound Name | N-hydroxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 10051060 |
| Molecular Formula | C19H24F5N3O4S |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | N-hydroxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclobutane-1-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(CCC(F)(F)C(F)(F)F)cn3)CC2)CCC1 |
| InChI | InChI=1S/C19H24F5N3O4S/c20-18(21,19(22,23)24)9-4-13-2-3-15(25-12-13)14-5-10-27(11-6-14)32(30,31)17(7-1-8-17)16(28)26-29/h2-3,12,14,29H,1,4-11H2,(H,26,28) |
| InChIKey | BYXFWXWVYODKAX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|