C25H30F5N5O4S — CID 10008591
N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonyl-1-pyridin-3-ylpiperidine-4-carboxamide (PubChem CID 10008591) has the molecular formula C25H30F5N5O4S and a molecular weight of 591.60 g/mol. Its IUPAC name is N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonyl-1-pyridin-3-ylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonyl-1-pyridin-3-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10008591 |
| Molecular Formula | C25H30F5N5O4S |
| Molecular Weight | 591.60 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonyl-1-pyridin-3-ylpiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(CCC(F)(F)C(F)(F)F)cn3)CC2)CCN(c2cccnc2)CC1 |
| InChI | InChI=1S/C25H30F5N5O4S/c26-24(27,25(28,29)30)8-5-18-3-4-21(32-16-18)19-6-12-35(13-7-19)40(38,39)23(22(36)33-37)9-14-34(15-10-23)20-2-1-11-31-17-20/h1-4,11,16-17,19,37H,5-10,12-15H2,(H,33,36) |
| InChIKey | QXNGUNMLECFVAT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|