C22H31F5N4O4S — CID 10076013
1-ethyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpiperidine-4-carboxamide (PubChem CID 10076013) has the molecular formula C22H31F5N4O4S and a molecular weight of 542.57 g/mol. Its IUPAC name is 1-ethyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-ethyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 10076013 |
| Molecular Formula | C22H31F5N4O4S |
| Molecular Weight | 542.57 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 1-ethyl-N-hydroxy-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylpiperidine-4-carboxamide |
| SMILES | CCN1CCC(C(=O)NO)(S(=O)(=O)N2CCC(c3ccc(CCC(F)(F)C(F)(F)F)cn3)CC2)CC1 |
| InChI | InChI=1S/C22H31F5N4O4S/c1-2-30-13-9-20(10-14-30,19(32)29-33)36(34,35)31-11-6-17(7-12-31)18-4-3-16(15-28-18)5-8-21(23,24)22(25,26)27/h3-4,15,17,33H,2,5-14H2,1H3,(H,29,32) |
| InChIKey | ZRZZPWHVDMKTBO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|