C20H26F5N3O4S — CID 10097468
N-hydroxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclopentane-1-carboxamide (PubChem CID 10097468) has the molecular formula C20H26F5N3O4S and a molecular weight of 499.50 g/mol. Its IUPAC name is N-hydroxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclopentane-1-carboxamide.
| Compound Name | N-hydroxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 10097468 |
| Molecular Formula | C20H26F5N3O4S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-hydroxy-1-[4-[5-(3,3,4,4,4-pentafluorobutyl)-2-pyridinyl]piperidin-1-yl]sulfonylcyclopentane-1-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(c3ccc(CCC(F)(F)C(F)(F)F)cn3)CC2)CCCC1 |
| InChI | InChI=1S/C20H26F5N3O4S/c21-19(22,20(23,24)25)10-5-14-3-4-16(26-13-14)15-6-11-28(12-7-15)33(31,32)18(17(29)27-30)8-1-2-9-18/h3-4,13,15,30H,1-2,5-12H2,(H,27,29) |
| InChIKey | AMGWSNQLJHYGRQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|