C31H35FN4O7S — CID 100511480
(2S)-N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 100511480) has the molecular formula C31H35FN4O7S and a molecular weight of 626.71 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100511480 |
| Molecular Formula | C31H35FN4O7S |
| Molecular Weight | 626.71 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | (2S)-N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(2-methoxy-N-methylsulfonyl-5-nitroanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1N(CC(=O)N(Cc1ccccc1F)[C@@H](Cc1ccccc1)C(=O)NC1CCCC1)S(C)(=O)=O |
| InChI | InChI=1S/C31H35FN4O7S/c1-43-29-17-16-25(36(39)40)19-27(29)35(44(2,41)42)21-30(37)34(20-23-12-6-9-15-26(23)32)28(18-22-10-4-3-5-11-22)31(38)33-24-13-7-8-14-24/h3-6,9-12,15-17,19,24,28H,7-8,13-14,18,20-21H2,1-2H3,(H,33,38)/t28-/m0/s1 |
| InChIKey | GFMPNNLJVCENRC-NDEPHWFRSA-N |
| XLogP | 4.21 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|