C30H33FN4O6S — CID 133248677
N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]-3-phenylpropanamide (PubChem CID 133248677) has the molecular formula C30H33FN4O6S and a molecular weight of 596.68 g/mol. Its IUPAC name is N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]-3-phenylpropanamide.
| Compound Name | N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 133248677 |
| Molecular Formula | C30H33FN4O6S |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | N-cyclopentyl-2-[(2-fluorophenyl)methyl-[2-(N-methylsulfonyl-3-nitroanilino)acetyl]amino]-3-phenylpropanamide |
| SMILES | CS(=O)(=O)N(CC(=O)N(Cc1ccccc1F)C(Cc1ccccc1)C(=O)NC1CCCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H33FN4O6S/c1-42(40,41)34(25-15-9-16-26(19-25)35(38)39)21-29(36)33(20-23-12-5-8-17-27(23)31)28(18-22-10-3-2-4-11-22)30(37)32-24-13-6-7-14-24/h2-5,8-12,15-17,19,24,28H,6-7,13-14,18,20-21H2,1H3,(H,32,37) |
| InChIKey | JDVGOWXOTAHDIH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|