C29H28N6O2 — CID 10051340
3-methyl-N-[(3R)-2-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-4,5-dihydro-3H-1-benzazepin-3-yl]but-2-enamide (PubChem CID 10051340) has the molecular formula C29H28N6O2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 3-methyl-N-[(3R)-2-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-4,5-dihydro-3H-1-benzazepin-3-yl]but-2-enamide.
| Compound Name | 3-methyl-N-[(3R)-2-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-4,5-dihydro-3H-1-benzazepin-3-yl]but-2-enamide |
|---|---|
| PubChem CID | 10051340 |
| Molecular Formula | C29H28N6O2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 3-methyl-N-[(3R)-2-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-4,5-dihydro-3H-1-benzazepin-3-yl]but-2-enamide |
| SMILES | CC(C)=CC(=O)N[C@@H]1CCc2ccccc2N(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)C1=O |
| InChI | InChI=1S/C29H28N6O2/c1-19(2)17-27(36)30-25-16-15-22-7-3-6-10-26(22)35(29(25)37)18-20-11-13-21(14-12-20)23-8-4-5-9-24(23)28-31-33-34-32-28/h3-14,17,25H,15-16,18H2,1-2H3,(H,30,36)(H,31,32,33,34)/t25-/m1/s1 |
| InChIKey | XEXHSHYJRPOOPK-RUZDIDTESA-N |
| XLogP | 4.46 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|