C33H39N7O5 — CID 18651432
3-methyl-N-[(3R)-2-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-4,5-dihydro-3H-1-benzazepin-3-yl]-3-[[(2S,3S)-2,3,4-trihydroxybutyl]amino]butanamide (PubChem CID 18651432) has the molecular formula C33H39N7O5 and a molecular weight of 613.72 g/mol. Its IUPAC name is 3-methyl-N-[(3R)-2-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-4,5-dihydro-3H-1-benzazepin-3-yl]-3-[[(2S,3S)-2,3,4-trihydroxybutyl]amino]butanamide.
| Compound Name | 3-methyl-N-[(3R)-2-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-4,5-dihydro-3H-1-benzazepin-3-yl]-3-[[(2S,3S)-2,3,4-trihydroxybutyl]amino]butanamide |
|---|---|
| PubChem CID | 18651432 |
| Molecular Formula | C33H39N7O5 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.30 |
| IUPAC Name | 3-methyl-N-[(3R)-2-oxo-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]-4,5-dihydro-3H-1-benzazepin-3-yl]-3-[[(2S,3S)-2,3,4-trihydroxybutyl]amino]butanamide |
| SMILES | CC(C)(CC(=O)N[C@@H]1CCc2ccccc2N(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)C1=O)NC[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C33H39N7O5/c1-33(2,34-18-28(42)29(43)20-41)17-30(44)35-26-16-15-23-7-3-6-10-27(23)40(32(26)45)19-21-11-13-22(14-12-21)24-8-4-5-9-25(24)31-36-38-39-37-31/h3-14,26,28-29,34,41-43H,15-20H2,1-2H3,(H,35,44)(H,36,37,38,39)/t26-,28+,29+/m1/s1 |
| InChIKey | PVEBQLSABJDAPD-FGUUHEIUSA-N |
| XLogP | 1.97 |
| TPSA | 176.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |